uric acid
An acid derived from purine, C5H4N4O3; like urea, used by animals as a means of excreting nitrogen. Deposits of crystals of uric acid and its salts in the body cause pain in gout and rheumatism.
| Uric acid | |
|---|---|
| General | |
| Systematic name |
7,9-dihydro-1H-purine- 2,6,8(3H)-trione |
| Other names | 2,6,8 Trioxypurine |
| Molecular formula | C5H4N4O3 |
| SMILES | C12NC(=O)NC(=O)C=2NC(=O)N1 |
| Molar mass | 168g/mol |
| Appearance | White Crystals |
| CAS number | 69-93-2 |
| Properties | |
| Density and phase | 1.87 |
| Solubility in water | Slightly |
| Melting point | decomposes on heating |
| Boiling point | N/A |
| Acidity (pKa) | 3.89 |
| Structure | |
| Molecular shape | ? |
| Coordination geometry | ? |
| Crystal structure | ? |
| Dipole moment | ? |
| Hazards | |
| MSDS | ? |
| Main hazards | ? |
| Flash point | ? °C |
| R/S statement | R: ? |
| RTECS number | ? |
| Thermodynamic data |
Phase behaviour Solid, liquid, gas |
| Spectral data | UV, IR, NMR, MS |
| Related compounds | |
| Related compounds |
hypoxanthine, xanthine, purine, urea, urate, ammonia |
|
Except where noted otherwise, data are given for materials in their standard state (at 25°C, 100 kPa) Infobox disclaimer and references |
|
Uric acid (or uricite) is an organic compound of carbon, nitrogen, oxygen and hydrogen with the formula C5H4N4O3.
User Comments Add a comment…